D-hydroorotic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

(4R)-2,6-dioxo-1,3-diazinane-4-carboxylic acid; D-hydroorotic acid
CAS RN:[5988-53-4]
Formula:C5H6N2O4; 158.11 g/mol
InChiKey:UFIVEPVSAGBUSI-UWTATZPHSA-N
SMILES:OC(=O)[C@H]1CC(=O)NC(=O)N1
Molecular structure of D-hydroorotic acid
Melting point:255 °C

Isomers

N-carbamoylmaleamic acid
Molecular structure of N-carbamoylmaleamic acid
L-dihydroorotic acid
Molecular structure of L-dihydroorotic acid
hydantoin-5-acetic acid
Molecular structure of hydantoin-5-acetic acid
D-hydroorotic acid
Molecular structure of D-hydroorotic acid
ibotenic acid
Molecular structure of ibotenic acid
methyl 4-methylfurazancarboxylate 2-oxide
Molecular structure of methyl 4-methylfurazancarboxylate 2-oxide
  ::